About 1-N'-anilino-2-N'-hydroxyethanediimidamide
1-N'-anilino-2-N'-hydroxyethanediimidamide (PubChem CID 135408234) has the molecular formula C8H11N5O
and a molecular weight of 193.21 g/mol. Its IUPAC name is 1-N'-anilino-2-N'-hydroxyethanediimidamide.
Molecular Properties
| Compound Name | 1-N'-anilino-2-N'-hydroxyethanediimidamide |
| PubChem CID | 135408234 |
| Molecular Formula | C8H11N5O |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 1-N'-anilino-2-N'-hydroxyethanediimidamide |
| SMILES | NC(=NO)C(N)=NNc1ccccc1 |
| InChI | InChI=1S/C8H11N5O/c9-7(8(10)13-14)12-11-6-4-2-1-3-5-6/h1-5,11,14H,(H2,9,12)(H2,10,13) |
| InChIKey | KZRQYOIQVKKDBF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 109.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-anilino-2-N'-hydroxyethanediimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-anilino-2-N'-hydroxyethanediimidamide?
The IUPAC name of 1-N'-anilino-2-N'-hydroxyethanediimidamide (CID 135408234) is 1-N'-anilino-2-N'-hydroxyethanediimidamide.
What is the SMILES notation for 1-N'-anilino-2-N'-hydroxyethanediimidamide?
The canonical SMILES for 1-N'-anilino-2-N'-hydroxyethanediimidamide is NC(=NO)C(N)=NNc1ccccc1.
What is the InChIKey of 1-N'-anilino-2-N'-hydroxyethanediimidamide?
The InChIKey is KZRQYOIQVKKDBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O/c9-7(8(10)13-14)12-11-6-4-2-1-3-5-6/h1-5,11,14H,(H2,9,12)(H2,10,13).
What are the key properties of 1-N'-anilino-2-N'-hydroxyethanediimidamide?
1-N'-anilino-2-N'-hydroxyethanediimidamide has a molecular weight of 193.21 g/mol, XLogP of 0.12, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-anilino-2-N'-hydroxyethanediimidamide is sourced from PubChem (CID 135408234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).