About (2R)-N'-anilino-3-methyl-2-(methylamino)butanimidamide
(2R)-N'-anilino-3-methyl-2-(methylamino)butanimidamide (PubChem CID 90782282) has the molecular formula C12H20N4
and a molecular weight of 220.32 g/mol. Its IUPAC name is (2R)-N'-anilino-3-methyl-2-(methylamino)butanimidamide.
Molecular Properties
| Compound Name | (2R)-N'-anilino-3-methyl-2-(methylamino)butanimidamide |
| PubChem CID | 90782282 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | (2R)-N'-anilino-3-methyl-2-(methylamino)butanimidamide |
| SMILES | CN[C@@H](C(N)=NNc1ccccc1)C(C)C |
| InChI | InChI=1S/C12H20N4/c1-9(2)11(14-3)12(13)16-15-10-7-5-4-6-8-10/h4-9,11,14-15H,1-3H3,(H2,13,16)/t11-/m1/s1 |
| InChIKey | HQJYIGLAJDWBOQ-LLVKDONJSA-N |
| XLogP | 1.61 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N'-anilino-3-methyl-2-(methylamino)butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N'-anilino-3-methyl-2-(methylamino)butanimidamide?
The IUPAC name of (2R)-N'-anilino-3-methyl-2-(methylamino)butanimidamide (CID 90782282) is (2R)-N'-anilino-3-methyl-2-(methylamino)butanimidamide.
What is the SMILES notation for (2R)-N'-anilino-3-methyl-2-(methylamino)butanimidamide?
The canonical SMILES for (2R)-N'-anilino-3-methyl-2-(methylamino)butanimidamide is CN[C@@H](C(N)=NNc1ccccc1)C(C)C.
What is the InChIKey of (2R)-N'-anilino-3-methyl-2-(methylamino)butanimidamide?
The InChIKey is HQJYIGLAJDWBOQ-LLVKDONJSA-N. The full InChI is InChI=1S/C12H20N4/c1-9(2)11(14-3)12(13)16-15-10-7-5-4-6-8-10/h4-9,11,14-15H,1-3H3,(H2,13,16)/t11-/m1/s1.
What are the key properties of (2R)-N'-anilino-3-methyl-2-(methylamino)butanimidamide?
(2R)-N'-anilino-3-methyl-2-(methylamino)butanimidamide has a molecular weight of 220.32 g/mol, XLogP of 1.61, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N'-anilino-3-methyl-2-(methylamino)butanimidamide is sourced from PubChem (CID 90782282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).