C14H13ClN4 — CID 134879796
(1E,2E)-N-phenyl-2-(phenylhydrazinylidene)ethanehydrazonoyl chloride (PubChem CID 134879796) has the molecular formula C14H13ClN4 and a molecular weight of 272.74 g/mol. Its IUPAC name is (1E,2E)-N-phenyl-2-(phenylhydrazinylidene)ethanehydrazonoyl chloride.
| Compound Name | (1E,2E)-N-phenyl-2-(phenylhydrazinylidene)ethanehydrazonoyl chloride |
|---|---|
| PubChem CID | 134879796 |
| Molecular Formula | C14H13ClN4 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (1E,2E)-N-phenyl-2-(phenylhydrazinylidene)ethanehydrazonoyl chloride |
| SMILES | ClC(/C=N/Nc1ccccc1)=N/Nc1ccccc1 |
| InChI | InChI=1S/C14H13ClN4/c15-14(19-18-13-9-5-2-6-10-13)11-16-17-12-7-3-1-4-8-12/h1-11,17-18H/b16-11+,19-14+ |
| InChIKey | UBPSUIYOQSJXAB-SRGIJIBBSA-N |
| XLogP | 3.75 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|