C19H16N4OS — CID 5370271
(2Z,3Z)-2,3-bis(phenylhydrazinylidene)-1-thiophen-2-ylpropan-1-one (PubChem CID 5370271) has the molecular formula C19H16N4OS and a molecular weight of 348.43 g/mol. Its IUPAC name is (2Z,3Z)-2,3-bis(phenylhydrazinylidene)-1-thiophen-2-ylpropan-1-one.
| Compound Name | (2Z,3Z)-2,3-bis(phenylhydrazinylidene)-1-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 5370271 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (2Z,3Z)-2,3-bis(phenylhydrazinylidene)-1-thiophen-2-ylpropan-1-one |
| SMILES | O=C(C(/C=N\Nc1ccccc1)=N\Nc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C19H16N4OS/c24-19(18-12-7-13-25-18)17(23-22-16-10-5-2-6-11-16)14-20-21-15-8-3-1-4-9-15/h1-14,21-22H/b20-14-,23-17- |
| InChIKey | VYIBLLCQBODPHX-ODWRTAAPSA-N |
| XLogP | 4.50 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|