C9H9N3O2 — CID 137266431
(2Z,3Z)-3-hydroxyimino-2-(phenylhydrazinylidene)propanal (PubChem CID 137266431) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is (2Z,3Z)-3-hydroxyimino-2-(phenylhydrazinylidene)propanal.
| Compound Name | (2Z,3Z)-3-hydroxyimino-2-(phenylhydrazinylidene)propanal |
|---|---|
| PubChem CID | 137266431 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | (2Z,3Z)-3-hydroxyimino-2-(phenylhydrazinylidene)propanal |
| SMILES | O=CC(/C=N\O)=N\Nc1ccccc1 |
| InChI | InChI=1S/C9H9N3O2/c13-7-9(6-10-14)12-11-8-4-2-1-3-5-8/h1-7,11,14H/b10-6-,12-9- |
| InChIKey | VYSJQEJPDSLNJP-LQBUGXQISA-N |
| XLogP | 1.11 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|