C20H26N4O6 — CID 98502367
(2R,3R,4S,5S,6S,7Z,8E)-7,8-bis(phenylhydrazinylidene)octane-1,2,3,4,5,6-hexol (PubChem CID 98502367) has the molecular formula C20H26N4O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S,7Z,8E)-7,8-bis(phenylhydrazinylidene)octane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3R,4S,5S,6S,7Z,8E)-7,8-bis(phenylhydrazinylidene)octane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 98502367 |
| Molecular Formula | C20H26N4O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (2R,3R,4S,5S,6S,7Z,8E)-7,8-bis(phenylhydrazinylidene)octane-1,2,3,4,5,6-hexol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)C(/C=N/Nc1ccccc1)=N\Nc1ccccc1 |
| InChI | InChI=1S/C20H26N4O6/c25-12-16(26)18(28)20(30)19(29)17(27)15(24-23-14-9-5-2-6-10-14)11-21-22-13-7-3-1-4-8-13/h1-11,16-20,22-23,25-30H,12H2/b21-11+,24-15-/t16-,17+,18-,19+,20-/m1/s1 |
| InChIKey | JERMDAVQYBUDDH-KJYCYCJSSA-N |
| XLogP | -0.65 |
| TPSA | 170.16 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|