C13H18N2O7 — CID 136810471
(2S,3S,4R,5S)-2,3,4,5,6-pentahydroxy-N-[(Z)-(2-hydroxyphenyl)methylideneamino]hexanamide (PubChem CID 136810471) has the molecular formula C13H18N2O7 and a molecular weight of 314.29 g/mol. Its IUPAC name is (2S,3S,4R,5S)-2,3,4,5,6-pentahydroxy-N-[(Z)-(2-hydroxyphenyl)methylideneamino]hexanamide.
| Compound Name | (2S,3S,4R,5S)-2,3,4,5,6-pentahydroxy-N-[(Z)-(2-hydroxyphenyl)methylideneamino]hexanamide |
|---|---|
| PubChem CID | 136810471 |
| Molecular Formula | C13H18N2O7 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (2S,3S,4R,5S)-2,3,4,5,6-pentahydroxy-N-[(Z)-(2-hydroxyphenyl)methylideneamino]hexanamide |
| SMILES | O=C(N/N=C\c1ccccc1O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C13H18N2O7/c16-6-9(18)10(19)11(20)12(21)13(22)15-14-5-7-3-1-2-4-8(7)17/h1-5,9-12,16-21H,6H2,(H,15,22)/b14-5-/t9-,10+,11-,12-/m0/s1 |
| InChIKey | HKMXVWDLNKWZHA-WGBZBXAESA-N |
| XLogP | -2.72 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|