C13H17ClN2O6 — CID 6060051
N-[(Z)-(4-chlorophenyl)methylideneamino]-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 6060051) has the molecular formula C13H17ClN2O6 and a molecular weight of 332.74 g/mol. Its IUPAC name is N-[(Z)-(4-chlorophenyl)methylideneamino]-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | N-[(Z)-(4-chlorophenyl)methylideneamino]-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 6060051 |
| Molecular Formula | C13H17ClN2O6 |
| Molecular Weight | 332.74 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | N-[(Z)-(4-chlorophenyl)methylideneamino]-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)cc1)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C13H17ClN2O6/c14-8-3-1-7(2-4-8)5-15-16-13(22)12(21)11(20)10(19)9(18)6-17/h1-5,9-12,17-21H,6H2,(H,16,22)/b15-5- |
| InChIKey | YQHAMXPFJLDMRQ-WCSRMQSCSA-N |
| XLogP | -1.77 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.74 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|