C15H22N2O8 — CID 137081252
(2R,3R,4R,5S)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 137081252) has the molecular formula C15H22N2O8 and a molecular weight of 358.35 g/mol. Its IUPAC name is (2R,3R,4R,5S)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | (2R,3R,4R,5S)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 137081252 |
| Molecular Formula | C15H22N2O8 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (2R,3R,4R,5S)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@H](O)[C@H](O)[C@H](O)[C@@H](O)CO)ccc1O |
| InChI | InChI=1S/C15H22N2O8/c1-2-25-11-5-8(3-4-9(11)19)6-16-17-15(24)14(23)13(22)12(21)10(20)7-18/h3-6,10,12-14,18-23H,2,7H2,1H3,(H,17,24)/b16-6-/t10-,12+,13+,14+/m0/s1 |
| InChIKey | CZCGLIDYPSEJQN-RCTZZOMTSA-N |
| XLogP | -2.32 |
| TPSA | 172.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|