C13H19NO7 — CID 7921985
(2S,3R,4R,5R,6R)-2,3,4,5,6,7-hexahydroxy-N-phenylheptanamide (PubChem CID 7921985) has the molecular formula C13H19NO7 and a molecular weight of 301.30 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2,3,4,5,6,7-hexahydroxy-N-phenylheptanamide.
| Compound Name | (2S,3R,4R,5R,6R)-2,3,4,5,6,7-hexahydroxy-N-phenylheptanamide |
|---|---|
| PubChem CID | 7921985 |
| Molecular Formula | C13H19NO7 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2,3,4,5,6,7-hexahydroxy-N-phenylheptanamide |
| SMILES | O=C(Nc1ccccc1)[C@@H](O)[C@H](O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H19NO7/c15-6-8(16)9(17)10(18)11(19)12(20)13(21)14-7-4-2-1-3-5-7/h1-5,8-12,15-20H,6H2,(H,14,21)/t8-,9-,10-,11-,12+/m1/s1 |
| InChIKey | SEACQUXQKVWSID-OOCWMUITSA-N |
| XLogP | -2.58 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |