C23H26N4O6 — CID 6399146
[2,3-diacetyloxy-4,5-bis(phenylhydrazinylidene)pentyl] acetate (PubChem CID 6399146) has the molecular formula C23H26N4O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is [2,3-diacetyloxy-4,5-bis(phenylhydrazinylidene)pentyl] acetate.
| Compound Name | [2,3-diacetyloxy-4,5-bis(phenylhydrazinylidene)pentyl] acetate |
|---|---|
| PubChem CID | 6399146 |
| Molecular Formula | C23H26N4O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | [2,3-diacetyloxy-4,5-bis(phenylhydrazinylidene)pentyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(C=NNc1ccccc1)=NNc1ccccc1 |
| InChI | InChI=1S/C23H26N4O6/c1-16(28)31-15-22(32-17(2)29)23(33-18(3)30)21(27-26-20-12-8-5-9-13-20)14-24-25-19-10-6-4-7-11-19/h4-14,22-23,25-26H,15H2,1-3H3 |
| InChIKey | OVUCAKLNVHAKSM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|