C30H30N8O10 — CID 135416120
[2,3,4-triacetyloxy-5,6-bis[(4-oxo-3H-quinazolin-2-yl)hydrazinylidene]hexyl] acetate (PubChem CID 135416120) has the molecular formula C30H30N8O10 and a molecular weight of 662.62 g/mol. Its IUPAC name is [2,3,4-triacetyloxy-5,6-bis[(4-oxo-3H-quinazolin-2-yl)hydrazinylidene]hexyl] acetate.
| Compound Name | [2,3,4-triacetyloxy-5,6-bis[(4-oxo-3H-quinazolin-2-yl)hydrazinylidene]hexyl] acetate |
|---|---|
| PubChem CID | 135416120 |
| Molecular Formula | C30H30N8O10 |
| Molecular Weight | 662.62 g/mol |
| Exact Mass | 662.21 |
| IUPAC Name | [2,3,4-triacetyloxy-5,6-bis[(4-oxo-3H-quinazolin-2-yl)hydrazinylidene]hexyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(C=NNc1nc2ccccc2c(=O)[nH]1)=NNc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C30H30N8O10/c1-15(39)45-14-24(46-16(2)40)26(48-18(4)42)25(47-17(3)41)23(36-38-30-33-22-12-8-6-10-20(22)28(44)35-30)13-31-37-29-32-21-11-7-5-9-19(21)27(43)34-29/h5-13,24-26H,14H2,1-4H3,(H2,32,34,37,43)(H2,33,35,38,44) |
| InChIKey | SLRYXMMYHBACJG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 245.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.62 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|