C20H24N2O8 — CID 98575148
[(Z,2S,3R,4R)-2,3,4-triacetyloxy-6-phenyldiazenylhex-5-enyl] acetate (PubChem CID 98575148) has the molecular formula C20H24N2O8 and a molecular weight of 420.42 g/mol. Its IUPAC name is [(Z,2S,3R,4R)-2,3,4-triacetyloxy-6-phenyldiazenylhex-5-enyl] acetate.
| Compound Name | [(Z,2S,3R,4R)-2,3,4-triacetyloxy-6-phenyldiazenylhex-5-enyl] acetate |
|---|---|
| PubChem CID | 98575148 |
| Molecular Formula | C20H24N2O8 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [(Z,2S,3R,4R)-2,3,4-triacetyloxy-6-phenyldiazenylhex-5-enyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](/C=C\N=N\c1ccccc1)OC(C)=O |
| InChI | InChI=1S/C20H24N2O8/c1-13(23)27-12-19(29-15(3)25)20(30-16(4)26)18(28-14(2)24)10-11-21-22-17-8-6-5-7-9-17/h5-11,18-20H,12H2,1-4H3/b11-10-,22-21+/t18-,19+,20-/m1/s1 |
| InChIKey | FEDNZHOZZFZXGV-WKGJFOMMSA-N |
| XLogP | 2.64 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|