C22H26O10 — CID 163044730
4,5,6,7-tetraacetyloxy-2-benzylhept-2-enoic acid (PubChem CID 163044730) has the molecular formula C22H26O10 and a molecular weight of 450.44 g/mol. Its IUPAC name is 4,5,6,7-tetraacetyloxy-2-benzylhept-2-enoic acid.
| Compound Name | 4,5,6,7-tetraacetyloxy-2-benzylhept-2-enoic acid |
|---|---|
| PubChem CID | 163044730 |
| Molecular Formula | C22H26O10 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 4,5,6,7-tetraacetyloxy-2-benzylhept-2-enoic acid |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(C=C(Cc1ccccc1)C(=O)O)OC(C)=O |
| InChI | InChI=1S/C22H26O10/c1-13(23)29-12-20(31-15(3)25)21(32-16(4)26)19(30-14(2)24)11-18(22(27)28)10-17-8-6-5-7-9-17/h5-9,11,19-21H,10,12H2,1-4H3,(H,27,28) |
| InChIKey | OJVHYUXWYIZITR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|