C20H22O7 — CID 122399261
[(2R,3S,4E,6E)-2,3-diacetyloxy-8-oxo-8-phenylocta-4,6-dienyl] acetate (PubChem CID 122399261) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is [(2R,3S,4E,6E)-2,3-diacetyloxy-8-oxo-8-phenylocta-4,6-dienyl] acetate.
| Compound Name | [(2R,3S,4E,6E)-2,3-diacetyloxy-8-oxo-8-phenylocta-4,6-dienyl] acetate |
|---|---|
| PubChem CID | 122399261 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | [(2R,3S,4E,6E)-2,3-diacetyloxy-8-oxo-8-phenylocta-4,6-dienyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](/C=C/C=C/C(=O)c1ccccc1)OC(C)=O |
| InChI | InChI=1S/C20H22O7/c1-14(21)25-13-20(27-16(3)23)19(26-15(2)22)12-8-7-11-18(24)17-9-5-4-6-10-17/h4-12,19-20H,13H2,1-3H3/b11-7+,12-8+/t19-,20+/m0/s1 |
| InChIKey | BVLXLAZJIAVKCX-PRABUYISSA-N |
| XLogP | 2.41 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|