C16H18OS2 — CID 71349861
6-methyl-7,7-bis(methylsulfanyl)-1-phenylhepta-2,4,6-trien-1-one (PubChem CID 71349861) has the molecular formula C16H18OS2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 6-methyl-7,7-bis(methylsulfanyl)-1-phenylhepta-2,4,6-trien-1-one.
| Compound Name | 6-methyl-7,7-bis(methylsulfanyl)-1-phenylhepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 71349861 |
| Molecular Formula | C16H18OS2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 6-methyl-7,7-bis(methylsulfanyl)-1-phenylhepta-2,4,6-trien-1-one |
| SMILES | CSC(SC)=C(C)C=CC=CC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18OS2/c1-13(16(18-2)19-3)9-7-8-12-15(17)14-10-5-4-6-11-14/h4-12H,1-3H3 |
| InChIKey | LFSHJKJWSXHEKL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|