C12H16OS2 — CID 14546229
(2E,4E,6E)-8-methyl-9,9-bis(methylsulfanyl)nona-2,4,6,8-tetraenal (PubChem CID 14546229) has the molecular formula C12H16OS2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (2E,4E,6E)-8-methyl-9,9-bis(methylsulfanyl)nona-2,4,6,8-tetraenal.
| Compound Name | (2E,4E,6E)-8-methyl-9,9-bis(methylsulfanyl)nona-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 14546229 |
| Molecular Formula | C12H16OS2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | (2E,4E,6E)-8-methyl-9,9-bis(methylsulfanyl)nona-2,4,6,8-tetraenal |
| SMILES | CSC(SC)=C(C)/C=C/C=C/C=C/C=O |
| InChI | InChI=1S/C12H16OS2/c1-11(12(14-2)15-3)9-7-5-4-6-8-10-13/h4-10H,1-3H3/b5-4+,8-6+,9-7+ |
| InChIKey | ODSLBWKNCKSUGO-WUJFNTSISA-N |
| XLogP | 3.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|