C10H16OS2 — CID 100963511
(4E)-2,4-dimethyl-1,1-bis(methylsulfanyl)hexa-1,4-dien-3-one (PubChem CID 100963511) has the molecular formula C10H16OS2 and a molecular weight of 216.37 g/mol. Its IUPAC name is (4E)-2,4-dimethyl-1,1-bis(methylsulfanyl)hexa-1,4-dien-3-one.
| Compound Name | (4E)-2,4-dimethyl-1,1-bis(methylsulfanyl)hexa-1,4-dien-3-one |
|---|---|
| PubChem CID | 100963511 |
| Molecular Formula | C10H16OS2 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | (4E)-2,4-dimethyl-1,1-bis(methylsulfanyl)hexa-1,4-dien-3-one |
| SMILES | C/C=C(\C)C(=O)C(C)=C(SC)SC |
| InChI | InChI=1S/C10H16OS2/c1-6-7(2)9(11)8(3)10(12-4)13-5/h6H,1-5H3/b7-6+ |
| InChIKey | HVHUCWMNXOGUKS-VOTSOKGWSA-N |
| XLogP | 3.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|