About (E)-3-methylpent-3-en-2-one;(Z)-3-methylpent-3-en-2-one;propan-2-one
(E)-3-methylpent-3-en-2-one;(Z)-3-methylpent-3-en-2-one;propan-2-one (PubChem CID 158336786) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is (E)-3-methylpent-3-en-2-one;(Z)-3-methylpent-3-en-2-one;propan-2-one.
Molecular Properties
| Compound Name | (E)-3-methylpent-3-en-2-one;(Z)-3-methylpent-3-en-2-one;propan-2-one |
| PubChem CID | 158336786 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (E)-3-methylpent-3-en-2-one;(Z)-3-methylpent-3-en-2-one;propan-2-one |
| SMILES | C/C=C(/C)C(C)=O.C/C=C(\C)C(C)=O.CC(C)=O |
| InChI | InChI=1S/2C6H10O.C3H6O/c2*1-4-5(2)6(3)7;1-3(2)4/h2*4H,1-3H3;1-2H3/b5-4+;5-4-; |
| InChIKey | GQRICJVFEGEWNG-CDEMTMJJSA-N |
| XLogP | 3.68 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-methylpent-3-en-2-one;(Z)-3-methylpent-3-en-2-one;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-methylpent-3-en-2-one;(Z)-3-methylpent-3-en-2-one;propan-2-one?
The IUPAC name of (E)-3-methylpent-3-en-2-one;(Z)-3-methylpent-3-en-2-one;propan-2-one (CID 158336786) is (E)-3-methylpent-3-en-2-one;(Z)-3-methylpent-3-en-2-one;propan-2-one.
What is the SMILES notation for (E)-3-methylpent-3-en-2-one;(Z)-3-methylpent-3-en-2-one;propan-2-one?
The canonical SMILES for (E)-3-methylpent-3-en-2-one;(Z)-3-methylpent-3-en-2-one;propan-2-one is C/C=C(/C)C(C)=O.C/C=C(\C)C(C)=O.CC(C)=O.
What is the InChIKey of (E)-3-methylpent-3-en-2-one;(Z)-3-methylpent-3-en-2-one;propan-2-one?
The InChIKey is GQRICJVFEGEWNG-CDEMTMJJSA-N. The full InChI is InChI=1S/2C6H10O.C3H6O/c2*1-4-5(2)6(3)7;1-3(2)4/h2*4H,1-3H3;1-2H3/b5-4+;5-4-;.
What are the key properties of (E)-3-methylpent-3-en-2-one;(Z)-3-methylpent-3-en-2-one;propan-2-one?
(E)-3-methylpent-3-en-2-one;(Z)-3-methylpent-3-en-2-one;propan-2-one has a molecular weight of 254.37 g/mol, XLogP of 3.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-methylpent-3-en-2-one;(Z)-3-methylpent-3-en-2-one;propan-2-one is sourced from PubChem (CID 158336786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).