About acetaldehyde;methane;propan-2-one
acetaldehyde;methane;propan-2-one (PubChem CID 159068439) has the molecular formula C7H18O2
and a molecular weight of 134.22 g/mol. Its IUPAC name is acetaldehyde;methane;propan-2-one.
Molecular Properties
| Compound Name | acetaldehyde;methane;propan-2-one |
| PubChem CID | 159068439 |
| Molecular Formula | C7H18O2 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.13 |
| IUPAC Name | acetaldehyde;methane;propan-2-one |
| SMILES | C.C.CC(C)=O.CC=O |
| InChI | InChI=1S/C3H6O.C2H4O.2CH4/c1-3(2)4;1-2-3;;/h1-2H3;2H,1H3;2*1H4 |
| InChIKey | JZIOFXLYRWEIOE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;methane;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;methane;propan-2-one?
The IUPAC name of acetaldehyde;methane;propan-2-one (CID 159068439) is acetaldehyde;methane;propan-2-one.
What is the SMILES notation for acetaldehyde;methane;propan-2-one?
The canonical SMILES for acetaldehyde;methane;propan-2-one is C.C.CC(C)=O.CC=O.
What is the InChIKey of acetaldehyde;methane;propan-2-one?
The InChIKey is JZIOFXLYRWEIOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C2H4O.2CH4/c1-3(2)4;1-2-3;;/h1-2H3;2H,1H3;2*1H4.
What are the key properties of acetaldehyde;methane;propan-2-one?
acetaldehyde;methane;propan-2-one has a molecular weight of 134.22 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;methane;propan-2-one is sourced from PubChem (CID 159068439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).