C5H7O4- — CID 167580573
acetaldehyde;2-oxo(1,2-13C2)propanoate (PubChem CID 167580573) has the molecular formula C5H7O4- and a molecular weight of 134.08 g/mol. Its IUPAC name is acetaldehyde;2-oxo(1,2-13C2)propanoate.
| Compound Name | acetaldehyde;2-oxo(1,2-13C2)propanoate |
|---|---|
| PubChem CID | 167580573 |
| Molecular Formula | C5H7O4- |
| Molecular Weight | 134.08 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | acetaldehyde;2-oxo(1,2-13C2)propanoate |
| SMILES | C[13CH]=O.C[13C](=O)[13C](=O)[O-] |
| InChI | InChI=1S/C3H4O3.C2H4O/c1-2(4)3(5)6;1-2-3/h1H3,(H,5,6);2H,1H3/p-1/i2+1,3+1;2+1 |
| InChIKey | HCXIAWQMKMZQOZ-IEWKWOGASA-M |
| XLogP | -1.47 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.08 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|