About dizinc;acetate;formate
dizinc;acetate;formate (PubChem CID 23296678) has the molecular formula C3H4O4Zn2+2
and a molecular weight of 234.84 g/mol. Its IUPAC name is dizinc;acetate;formate.
Molecular Properties
| Compound Name | dizinc;acetate;formate |
| PubChem CID | 23296678 |
| Molecular Formula | C3H4O4Zn2+2 |
| Molecular Weight | 234.84 g/mol |
| Exact Mass | 231.87 |
| IUPAC Name | dizinc;acetate;formate |
| SMILES | CC(=O)[O-].O=C[O-].[Zn+2].[Zn+2] |
| InChI | InChI=1S/C2H4O2.CH2O2.2Zn/c1-2(3)4;2-1-3;;/h1H3,(H,3,4);1H,(H,2,3);;/q;;2*+2/p-2 |
| InChIKey | VDGRPYNBKKBJNR-UHFFFAOYSA-L |
| XLogP | -2.88 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.84 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dizinc;acetate;formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dizinc;acetate;formate?
The IUPAC name of dizinc;acetate;formate (CID 23296678) is dizinc;acetate;formate.
What is the SMILES notation for dizinc;acetate;formate?
The canonical SMILES for dizinc;acetate;formate is CC(=O)[O-].O=C[O-].[Zn+2].[Zn+2].
What is the InChIKey of dizinc;acetate;formate?
The InChIKey is VDGRPYNBKKBJNR-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H4O2.CH2O2.2Zn/c1-2(3)4;2-1-3;;/h1H3,(H,3,4);1H,(H,2,3);;/q;;2*+2/p-2.
What are the key properties of dizinc;acetate;formate?
dizinc;acetate;formate has a molecular weight of 234.84 g/mol, XLogP of -2.88, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dizinc;acetate;formate is sourced from PubChem (CID 23296678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).