About zinc;antimony(3+);acetate
zinc;antimony(3+);acetate (PubChem CID 22763681) has the molecular formula C2H3O2SbZn+4
and a molecular weight of 246.19 g/mol. Its IUPAC name is zinc;antimony(3+);acetate.
Molecular Properties
| Compound Name | zinc;antimony(3+);acetate |
| PubChem CID | 22763681 |
| Molecular Formula | C2H3O2SbZn+4 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 243.84 |
| IUPAC Name | zinc;antimony(3+);acetate |
| SMILES | CC(=O)[O-].[Sb+3].[Zn+2] |
| InChI | InChI=1S/C2H4O2.Sb.Zn/c1-2(3)4;;/h1H3,(H,3,4);;/q;+3;+2/p-1 |
| InChIKey | ULAZXTPIVORDAX-UHFFFAOYSA-M |
| XLogP | -1.63 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;antimony(3+);acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;antimony(3+);acetate?
The IUPAC name of zinc;antimony(3+);acetate (CID 22763681) is zinc;antimony(3+);acetate.
What is the SMILES notation for zinc;antimony(3+);acetate?
The canonical SMILES for zinc;antimony(3+);acetate is CC(=O)[O-].[Sb+3].[Zn+2].
What is the InChIKey of zinc;antimony(3+);acetate?
The InChIKey is ULAZXTPIVORDAX-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.Sb.Zn/c1-2(3)4;;/h1H3,(H,3,4);;/q;+3;+2/p-1.
What are the key properties of zinc;antimony(3+);acetate?
zinc;antimony(3+);acetate has a molecular weight of 246.19 g/mol, XLogP of -1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;antimony(3+);acetate is sourced from PubChem (CID 22763681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).