About cesium 2-oxopropanoate
cesium 2-oxopropanoate (PubChem CID 23676701) has the molecular formula C3H3CsO3
and a molecular weight of 219.96 g/mol. Its IUPAC name is cesium 2-oxopropanoate.
Molecular Properties
| Compound Name | cesium 2-oxopropanoate |
| PubChem CID | 23676701 |
| Molecular Formula | C3H3CsO3 |
| Molecular Weight | 219.96 g/mol |
| Exact Mass | 219.91 |
| IUPAC Name | cesium 2-oxopropanoate |
| SMILES | CC(=O)C(=O)[O-].[Cs+] |
| InChI | InChI=1S/C3H4O3.Cs/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | DNGVGLGPVLVROB-UHFFFAOYSA-M |
| XLogP | -4.67 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.96 |
| LogP ≤ 5 | -4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze cesium 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium 2-oxopropanoate?
The IUPAC name of cesium 2-oxopropanoate (CID 23676701) is cesium 2-oxopropanoate.
What is the SMILES notation for cesium 2-oxopropanoate?
The canonical SMILES for cesium 2-oxopropanoate is CC(=O)C(=O)[O-].[Cs+].
What is the InChIKey of cesium 2-oxopropanoate?
The InChIKey is DNGVGLGPVLVROB-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H4O3.Cs/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+1/p-1.
What are the key properties of cesium 2-oxopropanoate?
cesium 2-oxopropanoate has a molecular weight of 219.96 g/mol, XLogP of -4.67, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cesium 2-oxopropanoate is sourced from PubChem (CID 23676701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).