About calcium;2-oxopropanoate;trihydrate
calcium;2-oxopropanoate;trihydrate (PubChem CID 18324280) has the molecular formula C3H9CaO6+
and a molecular weight of 181.18 g/mol. Its IUPAC name is calcium;2-oxopropanoate;trihydrate.
Molecular Properties
| Compound Name | calcium;2-oxopropanoate;trihydrate |
| PubChem CID | 18324280 |
| Molecular Formula | C3H9CaO6+ |
| Molecular Weight | 181.18 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | calcium;2-oxopropanoate;trihydrate |
| SMILES | CC(=O)C(=O)[O-].O.O.O.[Ca+2] |
| InChI | InChI=1S/C3H4O3.Ca.3H2O/c1-2(4)3(5)6;;;;/h1H3,(H,5,6);;3*1H2/q;+2;;;/p-1 |
| InChIKey | IQPYYBOKRXPHOK-UHFFFAOYSA-M |
| XLogP | -4.53 |
| TPSA | 151.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.18 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze calcium;2-oxopropanoate;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;2-oxopropanoate;trihydrate?
The IUPAC name of calcium;2-oxopropanoate;trihydrate (CID 18324280) is calcium;2-oxopropanoate;trihydrate.
What is the SMILES notation for calcium;2-oxopropanoate;trihydrate?
The canonical SMILES for calcium;2-oxopropanoate;trihydrate is CC(=O)C(=O)[O-].O.O.O.[Ca+2].
What is the InChIKey of calcium;2-oxopropanoate;trihydrate?
The InChIKey is IQPYYBOKRXPHOK-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H4O3.Ca.3H2O/c1-2(4)3(5)6;;;;/h1H3,(H,5,6);;3*1H2/q;+2;;;/p-1.
What are the key properties of calcium;2-oxopropanoate;trihydrate?
calcium;2-oxopropanoate;trihydrate has a molecular weight of 181.18 g/mol, XLogP of -4.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;2-oxopropanoate;trihydrate is sourced from PubChem (CID 18324280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).