C8H10O3 — CID 6450443
(E)-5-methylhept-4-ene-2,3,6-trione (PubChem CID 6450443) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is (E)-5-methylhept-4-ene-2,3,6-trione.
| Compound Name | (E)-5-methylhept-4-ene-2,3,6-trione |
|---|---|
| PubChem CID | 6450443 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (E)-5-methylhept-4-ene-2,3,6-trione |
| SMILES | CC(=O)C(=O)/C=C(\C)C(C)=O |
| InChI | InChI=1S/C8H10O3/c1-5(6(2)9)4-8(11)7(3)10/h4H,1-3H3/b5-4+ |
| InChIKey | QLIQXKXISJNMRN-SNAWJCMRSA-N |
| XLogP | 0.68 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|