C12H7F5O3 — CID 58898522
(2,3,4,5,6-pentafluorophenyl) (Z)-3-methyl-4-oxopent-2-enoate (PubChem CID 58898522) has the molecular formula C12H7F5O3 and a molecular weight of 294.18 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (Z)-3-methyl-4-oxopent-2-enoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (Z)-3-methyl-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 58898522 |
| Molecular Formula | C12H7F5O3 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (Z)-3-methyl-4-oxopent-2-enoate |
| SMILES | CC(=O)/C(C)=C\C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H7F5O3/c1-4(5(2)18)3-6(19)20-12-10(16)8(14)7(13)9(15)11(12)17/h3H,1-2H3/b4-3- |
| InChIKey | PGUMHTMMIYHQQI-ARJAWSKDSA-N |
| XLogP | 2.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|