C12H14F4O2 — CID 145302022
propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate (PubChem CID 145302022) has the molecular formula C12H14F4O2 and a molecular weight of 266.23 g/mol. Its IUPAC name is propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate.
| Compound Name | propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate |
|---|---|
| PubChem CID | 145302022 |
| Molecular Formula | C12H14F4O2 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate |
| SMILES | CC(=O)Oc1c(C)c(F)c(F)c(F)c1F.CCC |
| InChI | InChI=1S/C9H6F4O2.C3H8/c1-3-5(10)6(11)7(12)8(13)9(3)15-4(2)14;1-3-2/h1-2H3;3H2,1-2H3 |
| InChIKey | UKMMZEFDPWKJLS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|