About propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate
propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate (PubChem CID 145302022) has the molecular formula C12H14F4O2
and a molecular weight of 266.23 g/mol. Its IUPAC name is propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate.
Molecular Properties
| Compound Name | propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate |
| PubChem CID | 145302022 |
| Molecular Formula | C12H14F4O2 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate |
| SMILES | CC(=O)Oc1c(C)c(F)c(F)c(F)c1F.CCC |
| InChI | InChI=1S/C9H6F4O2.C3H8/c1-3-5(10)6(11)7(12)8(13)9(3)15-4(2)14;1-3-2/h1-2H3;3H2,1-2H3 |
| InChIKey | UKMMZEFDPWKJLS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate?
The IUPAC name of propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate (CID 145302022) is propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate.
What is the SMILES notation for propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate?
The canonical SMILES for propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate is CC(=O)Oc1c(C)c(F)c(F)c(F)c1F.CCC.
What is the InChIKey of propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate?
The InChIKey is UKMMZEFDPWKJLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F4O2.C3H8/c1-3-5(10)6(11)7(12)8(13)9(3)15-4(2)14;1-3-2/h1-2H3;3H2,1-2H3.
What are the key properties of propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate?
propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate has a molecular weight of 266.23 g/mol, XLogP of 3.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propane;(2,3,4,5-tetrafluoro-6-methylphenyl) acetate is sourced from PubChem (CID 145302022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).