C17H7F5O4 — CID 160867632
(2,3,4,5-tetrafluoro-6-methylphenyl) 7-fluoro-4-oxochromene-3-carboxylate (PubChem CID 160867632) has the molecular formula C17H7F5O4 and a molecular weight of 370.23 g/mol. Its IUPAC name is (2,3,4,5-tetrafluoro-6-methylphenyl) 7-fluoro-4-oxochromene-3-carboxylate.
| Compound Name | (2,3,4,5-tetrafluoro-6-methylphenyl) 7-fluoro-4-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 160867632 |
| Molecular Formula | C17H7F5O4 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | (2,3,4,5-tetrafluoro-6-methylphenyl) 7-fluoro-4-oxochromene-3-carboxylate |
| SMILES | Cc1c(F)c(F)c(F)c(F)c1OC(=O)c1coc2cc(F)ccc2c1=O |
| InChI | InChI=1S/C17H7F5O4/c1-6-11(19)12(20)13(21)14(22)16(6)26-17(24)9-5-25-10-4-7(18)2-3-8(10)15(9)23/h2-5H,1H3 |
| InChIKey | FKAHIJBNRRODFQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|