C13H14FNO3 — CID 130116518
tert-butyl N-(6-fluoro-1-benzofuran-3-yl)carbamate (PubChem CID 130116518) has the molecular formula C13H14FNO3 and a molecular weight of 251.26 g/mol. Its IUPAC name is tert-butyl N-(6-fluoro-1-benzofuran-3-yl)carbamate.
| Compound Name | tert-butyl N-(6-fluoro-1-benzofuran-3-yl)carbamate |
|---|---|
| PubChem CID | 130116518 |
| Molecular Formula | C13H14FNO3 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | tert-butyl N-(6-fluoro-1-benzofuran-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1coc2cc(F)ccc12 |
| InChI | InChI=1S/C13H14FNO3/c1-13(2,3)18-12(16)15-10-7-17-11-6-8(14)4-5-9(10)11/h4-7H,1-3H3,(H,15,16) |
| InChIKey | BKVZPRHYQAHOBO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |