C18H24N2O4 — CID 156699510
tert-butyl N-[3-(diethylcarbamoyl)-1-benzofuran-6-yl]carbamate (PubChem CID 156699510) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is tert-butyl N-[3-(diethylcarbamoyl)-1-benzofuran-6-yl]carbamate.
| Compound Name | tert-butyl N-[3-(diethylcarbamoyl)-1-benzofuran-6-yl]carbamate |
|---|---|
| PubChem CID | 156699510 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | tert-butyl N-[3-(diethylcarbamoyl)-1-benzofuran-6-yl]carbamate |
| SMILES | CCN(CC)C(=O)c1coc2cc(NC(=O)OC(C)(C)C)ccc12 |
| InChI | InChI=1S/C18H24N2O4/c1-6-20(7-2)16(21)14-11-23-15-10-12(8-9-13(14)15)19-17(22)24-18(3,4)5/h8-11H,6-7H2,1-5H3,(H,19,22) |
| InChIKey | XAFYQVCWSLHYFJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |