C17H23FN2O3 — CID 134190155
tert-butyl N-[3-(1-fluoropentyl)-1,2-benzoxazol-6-yl]carbamate (PubChem CID 134190155) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is tert-butyl N-[3-(1-fluoropentyl)-1,2-benzoxazol-6-yl]carbamate.
| Compound Name | tert-butyl N-[3-(1-fluoropentyl)-1,2-benzoxazol-6-yl]carbamate |
|---|---|
| PubChem CID | 134190155 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | tert-butyl N-[3-(1-fluoropentyl)-1,2-benzoxazol-6-yl]carbamate |
| SMILES | CCCCC(F)c1noc2cc(NC(=O)OC(C)(C)C)ccc12 |
| InChI | InChI=1S/C17H23FN2O3/c1-5-6-7-13(18)15-12-9-8-11(10-14(12)23-20-15)19-16(21)22-17(2,3)4/h8-10,13H,5-7H2,1-4H3,(H,19,21) |
| InChIKey | FELUDZVAOIINFA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |