C17H6F10O4 — CID 130209958
bis(2,3,4,5,6-pentafluorophenyl) 2-ethylpropanedioate (PubChem CID 130209958) has the molecular formula C17H6F10O4 and a molecular weight of 464.21 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl) 2-ethylpropanedioate.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl) 2-ethylpropanedioate |
|---|---|
| PubChem CID | 130209958 |
| Molecular Formula | C17H6F10O4 |
| Molecular Weight | 464.21 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl) 2-ethylpropanedioate |
| SMILES | CCC(C(=O)Oc1c(F)c(F)c(F)c(F)c1F)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H6F10O4/c1-2-3(16(28)30-14-10(24)6(20)4(18)7(21)11(14)25)17(29)31-15-12(26)8(22)5(19)9(23)13(15)27/h3H,2H2,1H3 |
| InChIKey | CQNSIXKUNFDDEL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|