C19H10F10O4 — CID 91734400
bis(2,3,4,5,6-pentafluorophenyl) 2,2-diethylpropanedioate (PubChem CID 91734400) has the molecular formula C19H10F10O4 and a molecular weight of 492.27 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl) 2,2-diethylpropanedioate.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl) 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91734400 |
| Molecular Formula | C19H10F10O4 |
| Molecular Weight | 492.27 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl) 2,2-diethylpropanedioate |
| SMILES | CCC(CC)(C(=O)Oc1c(F)c(F)c(F)c(F)c1F)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H10F10O4/c1-3-19(4-2,17(30)32-15-11(26)7(22)5(20)8(23)12(15)27)18(31)33-16-13(28)9(24)6(21)10(25)14(16)29/h3-4H2,1-2H3 |
| InChIKey | IFIFPJPMGPOFLS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.27 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|