C14H15F5O2 — CID 163990899
(2,3,4,5,6-pentafluorophenyl) 2-ethyl-3,3-dimethylbutanoate (PubChem CID 163990899) has the molecular formula C14H15F5O2 and a molecular weight of 310.26 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-ethyl-3,3-dimethylbutanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-ethyl-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 163990899 |
| Molecular Formula | C14H15F5O2 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-ethyl-3,3-dimethylbutanoate |
| SMILES | CCC(C(=O)Oc1c(F)c(F)c(F)c(F)c1F)C(C)(C)C |
| InChI | InChI=1S/C14H15F5O2/c1-5-6(14(2,3)4)13(20)21-12-10(18)8(16)7(15)9(17)11(12)19/h6H,5H2,1-4H3 |
| InChIKey | UANLLCYJPWPRLN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|