C10H15F3O3 — CID 174871940
(2,2,2-trifluoroacetyl) 2-ethyl-3,3-dimethylbutanoate (PubChem CID 174871940) has the molecular formula C10H15F3O3 and a molecular weight of 240.22 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 2-ethyl-3,3-dimethylbutanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 2-ethyl-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 174871940 |
| Molecular Formula | C10H15F3O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 2-ethyl-3,3-dimethylbutanoate |
| SMILES | CCC(C(=O)OC(=O)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C10H15F3O3/c1-5-6(9(2,3)4)7(14)16-8(15)10(11,12)13/h6H,5H2,1-4H3 |
| InChIKey | MHYVFXTYXAQMIL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|