C12H11F9O6 — CID 91694798
2,2-bis[(2,2,2-trifluoroacetyl)oxymethyl]butyl 2,2,2-trifluoroacetate (PubChem CID 91694798) has the molecular formula C12H11F9O6 and a molecular weight of 422.20 g/mol. Its IUPAC name is 2,2-bis[(2,2,2-trifluoroacetyl)oxymethyl]butyl 2,2,2-trifluoroacetate.
| Compound Name | 2,2-bis[(2,2,2-trifluoroacetyl)oxymethyl]butyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91694798 |
| Molecular Formula | C12H11F9O6 |
| Molecular Weight | 422.20 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 2,2-bis[(2,2,2-trifluoroacetyl)oxymethyl]butyl 2,2,2-trifluoroacetate |
| SMILES | CCC(COC(=O)C(F)(F)F)(COC(=O)C(F)(F)F)COC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H11F9O6/c1-2-9(3-25-6(22)10(13,14)15,4-26-7(23)11(16,17)18)5-27-8(24)12(19,20)21/h2-5H2,1H3 |
| InChIKey | AEKOLUVECIUHSH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|