C14H18F10O4 — CID 18359401
2,2-bis(hydroxymethyl)butyl 2-ethyl-2,3,3,4,4,5,5,6,6,6-decafluorohexanoate (PubChem CID 18359401) has the molecular formula C14H18F10O4 and a molecular weight of 440.27 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)butyl 2-ethyl-2,3,3,4,4,5,5,6,6,6-decafluorohexanoate.
| Compound Name | 2,2-bis(hydroxymethyl)butyl 2-ethyl-2,3,3,4,4,5,5,6,6,6-decafluorohexanoate |
|---|---|
| PubChem CID | 18359401 |
| Molecular Formula | C14H18F10O4 |
| Molecular Weight | 440.27 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 2,2-bis(hydroxymethyl)butyl 2-ethyl-2,3,3,4,4,5,5,6,6,6-decafluorohexanoate |
| SMILES | CCC(CO)(CO)COC(=O)C(F)(CC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H18F10O4/c1-3-9(5-25,6-26)7-28-8(27)10(15,4-2)11(16,17)12(18,19)13(20,21)14(22,23)24/h25-26H,3-7H2,1-2H3 |
| InChIKey | JVLQMPPNYDLYQC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|