C8H16O5S3 — CID 87135604
2,2-bis(hydroxymethyl)butyl 2,2-bis(sulfanyl)-2-sulfanyloxyacetate (PubChem CID 87135604) has the molecular formula C8H16O5S3 and a molecular weight of 288.41 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)butyl 2,2-bis(sulfanyl)-2-sulfanyloxyacetate.
| Compound Name | 2,2-bis(hydroxymethyl)butyl 2,2-bis(sulfanyl)-2-sulfanyloxyacetate |
|---|---|
| PubChem CID | 87135604 |
| Molecular Formula | C8H16O5S3 |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 2,2-bis(hydroxymethyl)butyl 2,2-bis(sulfanyl)-2-sulfanyloxyacetate |
| SMILES | CCC(CO)(CO)COC(=O)C(S)(S)OS |
| InChI | InChI=1S/C8H16O5S3/c1-2-7(3-9,4-10)5-12-6(11)8(14,15)13-16/h9-10,14-16H,2-5H2,1H3 |
| InChIKey | XZEVSIMZTNKDDW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|