C8H16O5S3 — CID 54558149
[3-hydroxy-2,2-bis(hydroxymethyl)propyl] 2,2,3-tris(sulfanyl)propanoate (PubChem CID 54558149) has the molecular formula C8H16O5S3 and a molecular weight of 288.41 g/mol. Its IUPAC name is [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 2,2,3-tris(sulfanyl)propanoate.
| Compound Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 2,2,3-tris(sulfanyl)propanoate |
|---|---|
| PubChem CID | 54558149 |
| Molecular Formula | C8H16O5S3 |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 2,2,3-tris(sulfanyl)propanoate |
| SMILES | O=C(OCC(CO)(CO)CO)C(S)(S)CS |
| InChI | InChI=1S/C8H16O5S3/c9-1-7(2-10,3-11)4-13-6(12)8(15,16)5-14/h9-11,14-16H,1-5H2 |
| InChIKey | ZOPZFQNRTMHXDT-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|