C8H15N3O7 — CID 23571865
[2,2-bis(carbamoyloxymethyl)-3-hydroxypropyl] carbamate (PubChem CID 23571865) has the molecular formula C8H15N3O7 and a molecular weight of 265.22 g/mol. Its IUPAC name is [2,2-bis(carbamoyloxymethyl)-3-hydroxypropyl] carbamate.
| Compound Name | [2,2-bis(carbamoyloxymethyl)-3-hydroxypropyl] carbamate |
|---|---|
| PubChem CID | 23571865 |
| Molecular Formula | C8H15N3O7 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | [2,2-bis(carbamoyloxymethyl)-3-hydroxypropyl] carbamate |
| SMILES | NC(=O)OCC(CO)(COC(N)=O)COC(N)=O |
| InChI | InChI=1S/C8H15N3O7/c9-5(13)16-2-8(1-12,3-17-6(10)14)4-18-7(11)15/h12H,1-4H2,(H2,9,13)(H2,10,14)(H2,11,15) |
| InChIKey | RZILDDAOKNNMTI-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 177.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|