C13H22O3 — CID 177417349
[2-(hydroxymethyl)-4-methyl-2-(2-methylprop-2-enyl)pent-4-enyl] acetate (PubChem CID 177417349) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is [2-(hydroxymethyl)-4-methyl-2-(2-methylprop-2-enyl)pent-4-enyl] acetate.
| Compound Name | [2-(hydroxymethyl)-4-methyl-2-(2-methylprop-2-enyl)pent-4-enyl] acetate |
|---|---|
| PubChem CID | 177417349 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | [2-(hydroxymethyl)-4-methyl-2-(2-methylprop-2-enyl)pent-4-enyl] acetate |
| SMILES | C=C(C)CC(CO)(COC(C)=O)CC(=C)C |
| InChI | InChI=1S/C13H22O3/c1-10(2)6-13(8-14,7-11(3)4)9-16-12(5)15/h14H,1,3,6-9H2,2,4-5H3 |
| InChIKey | ZLJKUMDGZNVVTJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|