C14H28N2O4 — CID 154076634
[5-(carbamoyloxymethyl)-3,5-diethylheptyl] carbamate (PubChem CID 154076634) has the molecular formula C14H28N2O4 and a molecular weight of 288.39 g/mol. Its IUPAC name is [5-(carbamoyloxymethyl)-3,5-diethylheptyl] carbamate.
| Compound Name | [5-(carbamoyloxymethyl)-3,5-diethylheptyl] carbamate |
|---|---|
| PubChem CID | 154076634 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | [5-(carbamoyloxymethyl)-3,5-diethylheptyl] carbamate |
| SMILES | CCC(CCOC(N)=O)CC(CC)(CC)COC(N)=O |
| InChI | InChI=1S/C14H28N2O4/c1-4-11(7-8-19-12(15)17)9-14(5-2,6-3)10-20-13(16)18/h11H,4-10H2,1-3H3,(H2,15,17)(H2,16,18) |
| InChIKey | VOPAZJLOVHKVOV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |