C11H20N4O6 — CID 121223659
[2-(carbamoylcarbamoyloxymethyl)-2-ethylbutyl] N-carbamoylcarbamate (PubChem CID 121223659) has the molecular formula C11H20N4O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is [2-(carbamoylcarbamoyloxymethyl)-2-ethylbutyl] N-carbamoylcarbamate.
| Compound Name | [2-(carbamoylcarbamoyloxymethyl)-2-ethylbutyl] N-carbamoylcarbamate |
|---|---|
| PubChem CID | 121223659 |
| Molecular Formula | C11H20N4O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [2-(carbamoylcarbamoyloxymethyl)-2-ethylbutyl] N-carbamoylcarbamate |
| SMILES | CCC(CC)(COC(=O)NC(N)=O)COC(=O)NC(N)=O |
| InChI | InChI=1S/C11H20N4O6/c1-3-11(4-2,5-20-9(18)14-7(12)16)6-21-10(19)15-8(13)17/h3-6H2,1-2H3,(H3,12,14,16,18)(H3,13,15,17,19) |
| InChIKey | WERHPPJDJYDSIE-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |