About 3-methylbutyl N-carbamoylcarbamate
3-methylbutyl N-carbamoylcarbamate (PubChem CID 3027873) has the molecular formula C7H14N2O3
and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-methylbutyl N-carbamoylcarbamate.
Molecular Properties
| Compound Name | 3-methylbutyl N-carbamoylcarbamate |
| PubChem CID | 3027873 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 3-methylbutyl N-carbamoylcarbamate |
| SMILES | CC(C)CCOC(=O)NC(N)=O |
| InChI | InChI=1S/C7H14N2O3/c1-5(2)3-4-12-7(11)9-6(8)10/h5H,3-4H2,1-2H3,(H3,8,9,10,11) |
| InChIKey | LJZROFZRNUBYJF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylbutyl N-carbamoylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl N-carbamoylcarbamate?
The IUPAC name of 3-methylbutyl N-carbamoylcarbamate (CID 3027873) is 3-methylbutyl N-carbamoylcarbamate.
What is the SMILES notation for 3-methylbutyl N-carbamoylcarbamate?
The canonical SMILES for 3-methylbutyl N-carbamoylcarbamate is CC(C)CCOC(=O)NC(N)=O.
What is the InChIKey of 3-methylbutyl N-carbamoylcarbamate?
The InChIKey is LJZROFZRNUBYJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O3/c1-5(2)3-4-12-7(11)9-6(8)10/h5H,3-4H2,1-2H3,(H3,8,9,10,11).
What are the key properties of 3-methylbutyl N-carbamoylcarbamate?
3-methylbutyl N-carbamoylcarbamate has a molecular weight of 174.20 g/mol, XLogP of 0.84, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl N-carbamoylcarbamate is sourced from PubChem (CID 3027873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).