About 3-methylbutyl N-ethenylcarbamate
3-methylbutyl N-ethenylcarbamate (PubChem CID 146374933) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 3-methylbutyl N-ethenylcarbamate.
Molecular Properties
| Compound Name | 3-methylbutyl N-ethenylcarbamate |
| PubChem CID | 146374933 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 3-methylbutyl N-ethenylcarbamate |
| SMILES | C=CNC(=O)OCCC(C)C |
| InChI | InChI=1S/C8H15NO2/c1-4-9-8(10)11-6-5-7(2)3/h4,7H,1,5-6H2,2-3H3,(H,9,10) |
| InChIKey | ZHMPSYWHVNPKST-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylbutyl N-ethenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl N-ethenylcarbamate?
The IUPAC name of 3-methylbutyl N-ethenylcarbamate (CID 146374933) is 3-methylbutyl N-ethenylcarbamate.
What is the SMILES notation for 3-methylbutyl N-ethenylcarbamate?
The canonical SMILES for 3-methylbutyl N-ethenylcarbamate is C=CNC(=O)OCCC(C)C.
What is the InChIKey of 3-methylbutyl N-ethenylcarbamate?
The InChIKey is ZHMPSYWHVNPKST-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-4-9-8(10)11-6-5-7(2)3/h4,7H,1,5-6H2,2-3H3,(H,9,10).
What are the key properties of 3-methylbutyl N-ethenylcarbamate?
3-methylbutyl N-ethenylcarbamate has a molecular weight of 157.21 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl N-ethenylcarbamate is sourced from PubChem (CID 146374933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).