C14H21N3O3 — CID 135481152
3-methylbutyl N-[N'-(3-methoxyphenyl)carbamimidoyl]carbamate (PubChem CID 135481152) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-methylbutyl N-[N'-(3-methoxyphenyl)carbamimidoyl]carbamate.
| Compound Name | 3-methylbutyl N-[N'-(3-methoxyphenyl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 135481152 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3-methylbutyl N-[N'-(3-methoxyphenyl)carbamimidoyl]carbamate |
| SMILES | COc1cccc(/N=C(\N)NC(=O)OCCC(C)C)c1 |
| InChI | InChI=1S/C14H21N3O3/c1-10(2)7-8-20-14(18)17-13(15)16-11-5-4-6-12(9-11)19-3/h4-6,9-10H,7-8H2,1-3H3,(H3,15,16,17,18) |
| InChIKey | YWGJVTHWBRTGOD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|