C8H12N4O3 — CID 86595100
2-(3-methoxyphenyl)guanidine;nitrous acid (PubChem CID 86595100) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)guanidine;nitrous acid.
| Compound Name | 2-(3-methoxyphenyl)guanidine;nitrous acid |
|---|---|
| PubChem CID | 86595100 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-(3-methoxyphenyl)guanidine;nitrous acid |
| SMILES | COc1cccc(N=C(N)N)c1.O=NO |
| InChI | InChI=1S/C8H11N3O.HNO2/c1-12-7-4-2-3-6(5-7)11-8(9)10;2-1-3/h2-5H,1H3,(H4,9,10,11);(H,2,3) |
| InChIKey | IAJRKWHDQLHQNV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|