C16H24N6O4S — CID 131842572
bis(2-(3-methylphenyl)guanidine);sulfuric acid (PubChem CID 131842572) has the molecular formula C16H24N6O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is bis(2-(3-methylphenyl)guanidine);sulfuric acid.
| Compound Name | bis(2-(3-methylphenyl)guanidine);sulfuric acid |
|---|---|
| PubChem CID | 131842572 |
| Molecular Formula | C16H24N6O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | bis(2-(3-methylphenyl)guanidine);sulfuric acid |
| SMILES | Cc1cccc(N=C(N)N)c1.Cc1cccc(N=C(N)N)c1.O=S(=O)(O)O |
| InChI | InChI=1S/2C8H11N3.H2O4S/c2*1-6-3-2-4-7(5-6)11-8(9)10;1-5(2,3)4/h2*2-5H,1H3,(H4,9,10,11);(H2,1,2,3,4) |
| InChIKey | VMBGJMQCUMHOMR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 203.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|