C8H12N4O5S — CID 67269255
2-(3-methylsulfonylphenyl)guanidine;nitric acid (PubChem CID 67269255) has the molecular formula C8H12N4O5S and a molecular weight of 276.27 g/mol. Its IUPAC name is 2-(3-methylsulfonylphenyl)guanidine;nitric acid.
| Compound Name | 2-(3-methylsulfonylphenyl)guanidine;nitric acid |
|---|---|
| PubChem CID | 67269255 |
| Molecular Formula | C8H12N4O5S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-(3-methylsulfonylphenyl)guanidine;nitric acid |
| SMILES | CS(=O)(=O)c1cccc(N=C(N)N)c1.O=[N+]([O-])O |
| InChI | InChI=1S/C8H11N3O2S.HNO3/c1-14(12,13)7-4-2-3-6(5-7)11-8(9)10;2-1(3)4/h2-5H,1H3,(H4,9,10,11);(H,2,3,4) |
| InChIKey | MHSAOZFONKMZRX-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 161.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|